| Name |
Cyanidin 3-(6''-acetylglucoside) |
| Formula |
C23H23O12 |
| Mw |
491.1189512 |
| CAS RN |
133080-31-6 |
| C_ID |
C00006793
, 
|
| InChIKey |
HBXXDBKJLPLXPR-LANRGVTQNA-O |
| InChICode |
InChI=1S/C23H22O12/c1-9(24)32-8-18-19(29)20(30)21(31)23(35-18)34-17-7-12-14(27)5-11(25)6-16(12)33-22(17)10-2-3-13(26)15(28)4-10/h2-7,18-21,23,29-31H,8H2,1H3,(H3-,25,26,27,28)/p+1/t18-,19-,20+,21-,23-/m1/s1 |
| SMILES |
CC(=O)OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium schoenoprasum  | Ref. |
| Plantae | Fabaceae | Amphithalea spp. | Ref. |
| Plantae | Fabaceae | Coelidium spp. | Ref. |
| Plantae | Fabaceae | Hypocalyptus spp. | Ref. |
| Plantae | Fabaceae | Liparia spp. | Ref. |
| Plantae | Fabaceae | Virgilia divaricata | Ref. |
| Plantae | Fabaceae | Virgilia oroboides | Ref. |
| Plantae | Poaceae | Panicum melinis | Ref. |
| Plantae | Poaceae | Pennisetum setaceum | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Virgilia oroboides | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Gonzalez-San,J.Sci.Food Agric.,51,(1990),337
Van Wyk,Biochem.Syst.Ecol.,22,(1994),813 |
|---|
|