| Name |
Oenin Malvidin 3-O-beta-D-glucopyranoside |
| Formula |
C23H25O12 |
| Mw |
493.13460127 |
| CAS RN |
7228-78-6 |
| C_ID |
C00006735
, 
|
| InChIKey |
PXUQTDZNOHRWLI-RVBSYNOMNA-O |
| InChICode |
InChI=1S/C23H24O12/c1-31-14-3-9(4-15(32-2)18(14)27)22-16(7-11-12(26)5-10(25)6-13(11)33-22)34-23-21(30)20(29)19(28)17(8-24)35-23/h3-7,17,19-21,23-24,28-30H,8H2,1-2H3,(H2-,25,26,27)/p+1/t17-,19-,20-,21+,23-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Berberidaceae | Berberis spp. | Ref. |
| Plantae | Coriariaceae | Coriaria myrtifolia | Ref. |
| Plantae | Ericaceae | Gaylussacia spp. | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Fabaceae | Amphithalea spp. | Ref. |
| Plantae | Fabaceae | Canavalia gladiata  | Ref. |
| Plantae | Fabaceae | Canavalia lineata | Ref. |
| Plantae | Fabaceae | Canavalia spp. | Ref. |
| Plantae | Fabaceae | Cercis chinensis | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Coelidium spp. | Ref. |
| Plantae | Fabaceae | Hypocalyptus spp. | Ref. |
| Plantae | Fabaceae | Liparia spp. | Ref. |
| Plantae | Fabaceae | Mucuna macrocarpa | Ref. |
| Plantae | Fabaceae | Mucuna sempervirens | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vigna subterranea  | Ref. |
| Plantae | Geraniaceae | Erodium cicutarium  | Ref. |
| Plantae | Hyacinthaceae | Muscari armeniacum  | Ref. |
| Plantae | Lythraceae | Lagerstroemia indica  | Ref. |
| Plantae | Malvaceae | Hibiscus syriacus  | Ref. |
| Plantae | Malvaceae | Malva sylvestris  | Ref. |
| Plantae | Myrsinaceae | Anagallis arvensis  | Ref. |
| Plantae | Myrsinaceae | Ardisia humilis | Ref. |
| Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
| Plantae | Myrtaceae | Metrosideros spp. | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Onagraceae | Fuchsia spp. | Ref. |
| Plantae | Passifloraceae | Passiflora quadrangularis  | Ref. |
| Plantae | Pinaceae | Abies spp. | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Primulaceae | Primula spp. | Ref. |
| Plantae | Saxifragaceae | Tolmiea menziesii | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vaccinium spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann.,408,(1915),83 |
|---|
|