| Name |
Delphinidin 3-rutinoside-5-glucoside |
| Formula |
C33H41O21 |
| Mw |
773.21403338 |
| CAS RN |
29837-24-9 |
| C_ID |
C00006717
, 
|
| InChIKey |
BMDKCVRDDZIEMR-WJTMRUGJNA-O |
| InChICode |
InChI=1S/C33H40O21/c1-9-20(38)24(42)27(45)31(49-9)48-8-19-23(41)26(44)29(47)33(54-19)52-17-6-12-15(50-30(17)10-2-13(36)21(39)14(37)3-10)4-11(35)5-16(12)51-32-28(46)25(43)22(40)18(7-34)53-32/h2-6,9,18-20,22-29,31-34,38,40-47H,7-8H2,1H3,(H3-,35,36,37,39)/p+1/t9-,18+,19-,20+,22-,23-,24+,25+,26-,27-,28-,29-,31-,32-,33-/m1/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc4c(O[C@@H]5OC(CO)[C@@H](O)[C@H](O)C5O)cc(O)cc4[o+]c3-c3cc(O)c(O)c(O)c3)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Fabaceae | Vicia villosa  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Ranunculaceae | Consolida orientalis  | Ref. |
| Plantae | Solanaceae | Petunia reitzii | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum melongena  | Ref. |
|
|
zoom in
| Organism | Solanum melongena | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Tanchev,Phytochem.,9,(1970),1681
Sulyok,Studies in Org.Chem.(Amsterdam),23,(1986),261 |
|---|
|