| Name |
(2S)-Naringenin 6-C-beta-D-glucopyranoside Hemiphloin 6-C-Glucosylnaringenin (S)-6-beta-D-Glucopyranosyl-4',5,7-trihydroxyflavanone (2S)-6-beta-D-Glucopyranosyl-2,3-dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
3682-03-9 |
| C_ID |
C00006091
, 
|
| InChIKey |
QKPKGDDHOGIEOO-RLNQMRIPNA-N |
| InChICode |
InChI=1S/C21H22O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-4,6,12,14,17,19-23,25-29H,5,7H2/t12-,14+,17+,19-,20+,21-/m0/s1 |
| SMILES |
O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Fabaceae | Acacia retinodes | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Liliaceae | Tulipa gesneriana  | Ref. |
| Plantae | Myrsinaceae | Ardisia pusilla | Ref. |
| Plantae | Myrtaceae | Eucalyptus hemiphloia | Ref. |
|
|
zoom in
| Organism | Eucalyptus hemiphloia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Hillis,Aust.J.Chem.,16,(1963),147
Budzianowski,Phytochem.,17,(1978),2044 |
|---|
|