| Name |
Syringetin 3-galactoside |
| Formula |
C23H24O13 |
| Mw |
508.12169086 |
| CAS RN |
55025-56-4 |
| C_ID |
C00005776
, 
|
| InChIKey |
JMFWYRWPJVEZPV-BGBKNLKJNA-N |
| InChICode |
InChI=1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17+,19-,20-,23+/m1/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@H](O)C(O)C2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Anthyllis sericea | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Myrsinaceae | Lysimachia nummularia  | Ref. |
| Plantae | Myrsinaceae | Lysimachia vulgaris var. davurica  | Ref. |
| Plantae | Philydraceae | Philydrum lanuginosum | Ref. |
| Plantae | Restionaceae | Chondropetalum tectolum | Ref. |
| Plantae | Restionaceae | Elegia cuspidata | Ref. |
|
|
zoom in
| Organism | Elegia cuspidata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Bohm,Phytochem.,14,(1975),315
Harborne,Phytochem.,18,(1979),1323 |
|---|
|