| Name |
Laricitrin 3-glucoside |
| Formula |
C22H22O13 |
| Mw |
494.10604079 |
| CAS RN |
39986-90-8 |
| C_ID |
C00005761
, 
|
| InChIKey |
ODXINVOINFDDDD-UWKRGFSFNA-N |
| InChICode |
InChI=1S/C22H22O13/c1-32-12-3-7(2-10(26)15(12)27)20-21(17(29)14-9(25)4-8(24)5-11(14)33-20)35-22-19(31)18(30)16(28)13(6-23)34-22/h2-5,13,16,18-19,22-28,30-31H,6H2,1H3/t13-,16-,18-,19-,22+/m1/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)cc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Larix decidua  | Ref. |
| Plantae | Pinaceae | Larix laricina  | Ref. |
| Plantae | Pinaceae | Larix sibirica | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pinus jeffreyi | Ref. |
| Plantae | Saxifragaceae | Heuchera micrantha | Ref. |
| Plantae | Saxifragaceae | Heuchera villosa | Ref. |
| Plantae | Vitaceae | Vitis vinifera cv.Petit Verdot  | Ref. |
|
|
zoom in
| Organism | Heuchera micrantha | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Tykavkina,Khim.Prir.Soedin.,10,(1974),157
Wells,Can.J.Bot.,58,(1980),1459 |
|---|
|