| Name |
Isorhamnetin 3-O-robinobioside Isorhamnetin 3-robinobioside Isorhamnetin-3-O-robinobioside |
| Formula |
C28H32O16 |
| Mw |
624.16903498 |
| CAS RN |
53584-69-3 |
| C_ID |
C00005538
, 
|
| InChIKey |
UIDGLYUNOUKLBM-QMCFYMAJNA-N |
| InChICode |
InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(43-16)44-26-20(34)17-13(31)6-11(29)7-15(17)42-25(26)10-3-4-12(30)14(5-10)39-2/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3/t9-,16-,18-,19+,21-,22-,23-,24+,27+,28-/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(CO[C@@H]3OC(C)[C@H](O)[C@H](O)C3O)[C@H](O)C(O)C2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Actinidiaceae | Actinidia polygama  | Ref. |
| Plantae | Amaranthaceae | Aerva javanica  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
| Plantae | Asteraceae | Bellis perennis  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata | Ref. |
| Plantae | Chenopodiaceae | Chenopodium spp. | Ref. |
| Plantae | Convallariaceae | Convallaria keiskei  | Ref. |
| Plantae | Erythropalaceae | Scorodocarpus borneensis | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Myrsinaceae | Lysimachia spp. | Ref. |
| Plantae | Nitrariaceae | Nitraria retusa | Ref. |
| Plantae | Primulaceae | Primula officinalis  | Ref. |
| Plantae | Rosaceae | Pyrus communis  | Ref. |
|
|
zoom in
| Organism | Convallaria keiskei | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Crawford,Biochem.Syst.Ecol.,6,(1978),189
Buschi,J.Nat.Prod.,45,(1982),557 |
|---|
|