| Name |
Rhamnetin 3-galactoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
38975-81-4 |
| C_ID |
C00005505
, 
|
| InChIKey |
PHEWILLIAJUBQE-HTTJNPAHNA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-9-5-12(26)15-13(6-9)32-20(8-2-3-10(24)11(25)4-8)21(17(15)28)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16+,18+,19-,22+/m1/s1 |
| SMILES |
COc1cc(O)c2c(=O)c(O[C@@H]3O[C@H](CO)[C@H](O)C(O)C3O)c(-c3ccc(O)c(O)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Campanulaceae/Lobeliaceae | Campanula cephalotes | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula rotundifolia | Ref. |
| Plantae | Euphorbiaceae | Euphorbia hypericifolia  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia prostrata  | Ref. |
| Plantae | Fabaceae | Anthyllis onobrychioides | Ref. |
| Plantae | Fabaceae | Astragalus floccosifolius | Ref. |
| Plantae | Fabaceae | Oxytropis ochrocephala | Ref. |
|
|
zoom in
| Organism | Oxytropis ochrocephala | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Teslov,Khim.Prir.Soedin.,8,(1972),392
Saleh,Phytochem.,24,(1985),371 |
|---|
|