| Name |
Quercetin 3-(2Gal-rhamnosyl-robinobioside) |
| Formula |
C33H40O20 |
| Mw |
756.21129372 |
| CAS RN |
124151-38-8 |
| C_ID |
C00005444
, 
|
| InChIKey |
HKNBJSRIYRDSLB-GHRXHERNNA-N |
| InChICode |
InChI=1S/C33H40O20/c1-9-19(38)23(42)26(45)31(48-9)47-8-17-21(40)25(44)30(53-32-27(46)24(43)20(39)10(2)49-32)33(51-17)52-29-22(41)18-15(37)6-12(34)7-16(18)50-28(29)11-3-4-13(35)14(36)5-11/h3-7,9-10,17,19-21,23-27,30-40,42-46H,8H2,1-2H3/t9-,10+,17+,19-,20-,21-,23-,24+,25-,26-,27-,30+,31+,32-,33-/m0/s1 |
| SMILES |
CC1O[C@@H](OC2C(O)[C@@H](O)C(CO[C@@H]3OC(C)[C@H](O)[C@H](O)C3O)O[C@H]2Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Asclepias curassavica  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium pallidicaule | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Alangium platanifolium | Ref. |
| Plantae | Myrsinaceae | Lysimachia fortunei | Ref. |
| Plantae | Myrsinaceae | Lysimachia nummularia  | Ref. |
| Plantae | Primulaceae | Primula officinalis  | Ref. |
|
|
zoom in
| Organism | Primula officinalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Karl,Planta Med.,41,(1981),96
Yasukawa,Phytochem.,28,(1989),2215 |
|---|
|