| Name |
Quercetin 3'-glucoside 3,5,7,3',4'-Pentahydroxyflavone Quercetin-3'-O-glucoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
19254-30-9 |
| C_ID |
C00005386
, 
|
| InChIKey |
YLWQTYZKYGNKPI-HSKIRFKCNA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-13-15(26)17(28)19(30)21(33-13)32-11-3-7(1-2-9(11)24)20-18(29)16(27)14-10(25)4-8(23)5-12(14)31-20/h1-5,13,15,17,19,21-26,28-30H,6H2/t13-,15-,17+,19-,21-/m1/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)c(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Gossypium arboreum  | Ref. |
| Plantae | Malvaceae | Gossypium herbaceum  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
| Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Saxifragaceae | Saxifraga tolmiei | Ref. |
|
|
zoom in
| Organism | Aesculus hippocastanum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Hergert,J.Org.Chem.,23,(1958),700
Farkas,Chem.Ber.,105,(1972),3505 |
|---|
|