| Name |
6-Hydroxykaempferol 7-glucoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
70056-55-2 |
| C_ID |
C00005307
, 
|
| InChIKey |
IYEWEDZIDUAUTD-BNLZDKBQNA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-11-14(25)17(28)19(30)21(33-11)32-10-5-9-12(15(26)13(10)24)16(27)18(29)20(31-9)7-1-3-8(23)4-2-7/h1-5,11,14,17,19,21-26,28-30H,6H2/t11-,14+,17-,19+,21+/m0/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chrysactinia mexicana | Ref. |
| Plantae | Asteraceae | Eupatorium glandulosum | Ref. |
| Plantae | Asteraceae | Neurolaena lobata  | Ref. |
| Plantae | Asteraceae | Neurolaena macrocephala | Ref. |
| Plantae | Asteraceae | Neurolaena oaxacana | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Tagetes erecta  | Ref. |
| Plantae | Asteraceae | Tetragonotheca texana | Ref. |
|
|
zoom in
| Organism | Tagetes erecta | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Bacon,Phytochem.,17,(1978),1939
Ulubelen,J.Nat.Prod.,44,(1981),457 |
|---|
|