| Name |
Persicarin |
| Formula |
C16H12O10S |
| Mw |
396.01511734 |
| CAS RN |
549-31-5 |
| C_ID |
C00004968
, 
|
| InChIKey |
CZFNXFXZXWDYMZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O10S/c1-24-11-4-7(2-3-9(11)18)15-16(26-27(21,22)23)14(20)13-10(19)5-8(17)6-12(13)25-15/h2-6,17-19H,1H3,(H,21,22,23) |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OS(=O)(=O)O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Oenanthe javanica  | Ref. |
| Plantae | Apiaceae | Oenanthe stolonifera  | Ref. |
| Plantae | Asteraceae | Flaveria bidentis  | Ref. |
| Plantae | Asteraceae | Iphiona scabra | Ref. |
| Plantae | Asteraceae | Pluchea dioscorides  | Ref. |
| Plantae | Asteraceae | Senecio spp.  | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper  | Ref. |
| Plantae | Polygonaceae | Polygonum thunbergii | Ref. |
|
|
zoom in
| Organism | Polygonum hydropiper | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kawaguchi,J.Pharm.Soc.Jpn.,57,(1937),180 |
|---|
|