| Name |
5,7,4'-Trihydroxy-3,6,8,3'-tetramethoxyflavone 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O9 |
| Mw |
390.09508217 |
| CAS RN |
58130-91-9 |
| C_ID |
C00004794
, 
|
| InChIKey |
DEQJJTUOVGHXHW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O9/c1-24-10-7-8(5-6-9(10)20)15-18(26-3)13(22)11-12(21)17(25-2)14(23)19(27-4)16(11)28-15/h5-7,20-21,23H,1-4H3 |
| SMILES |
COc1cc(-c2oc3c(OC)c(O)c(OC)c(O)c3c(=O)c2OC)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis solieri | Ref. |
| Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
| Plantae | Asteraceae | Gutierrezia sarothrae | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
| Plantae | Cleomaceae | Polanisia trachysperma | Ref. |
| Plantae | Rosaceae | Rosa centifolia  | Ref. |
|
|
zoom in
| Organism | Rosa centifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Star,Phytochem.,14,(1975),2275 |
|---|
|