| Name |
Araneosol 5,7-Dihydroxy-3,4',6,8-tetramethoxyflavone 5,7-Dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
50461-86-4 |
| C_ID |
C00004671
, 
|
| InChIKey |
UZIFGCHUAVTVIL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-10-7-5-9(6-8-10)15-18(25-3)13(21)11-12(20)17(24-2)14(22)19(26-4)16(11)27-15/h5-8,20,22H,1-4H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(O)c(OC)c(O)c3c(=O)c2OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia grayi | Ref. |
| Plantae | Asteraceae | Anaphalis araneosa | Ref. |
| Plantae | Asteraceae | Artemisia ludoviciana | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Rosaceae | Rosa centifolia  | Ref. |
| Plantae | Rutaceae | Drummondita calida | Ref. |
|
|
zoom in
| Organism | Drummondita calida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Herz,Tetrahedron Lett.,(1973),2571 |
|---|
|