| Name |
Dillenetin 3',4'-Dimethoxyquercetin 3,5,7-Trihydroxy-3',4'-dimethoxyflavone 2-(3,4-Dimethoxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
3306-29-4 |
| C_ID |
C00004644
, 
|
| InChIKey |
MHALJYZRPGYQSI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-11-4-3-8(5-12(11)23-2)17-16(21)15(20)14-10(19)6-9(18)7-13(14)24-17/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arnica chamissonis | Ref. |
| Plantae | Asteraceae | Baccharis salicifolia  | Ref. |
| Plantae | Asteraceae | Balsamorhiza deltoidea | Ref. |
| Plantae | Asteraceae | Chromolaena odorata  | Ref. |
| Plantae | Asteraceae | Pulicaria arabica | Ref. |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
|
|
zoom in
| Organism | Gossypium hirsutum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Struck,J. Agric. Food Chem.,18,(1970),548
Pavanasasivam,J.Chem.Soc.Perkin Trans,1,(1975),612 |
|---|
|