| Name |
Luteolin 3'-beta-D-glucopyranoside Luteolin 3'-O-beta-glucoside Luteolin 3'-glucoside Dracocephaloside Luteolin 3'-O-glucoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
5154-41-6 |
| C_ID |
C00004273
, 
|
| InChIKey |
VNTMXJLNIJFLIF-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)31-14-3-8(1-2-10(14)24)13-6-12(26)17-11(25)4-9(23)5-15(17)30-13/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dioclea lasiophylla | Ref. |
| Plantae | Fabaceae | Lathyrus pratensis | Ref. |
| Plantae | Fabaceae | Oxytropis campestris | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum var.angustifolium  | Ref. |
| Plantae | Labiatae | Dracocephalum thymiflorum | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
|
|
zoom in
| Organism | Dracocephalum thymiflorum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Litvinenko,Chem.Abstr.,63,(1965),10223 |
|---|
|