| Name |
Rhoifolin (-)-Rhoifolin |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
17306-46-6 |
| C_ID |
C00004157
, 
|
| InChIKey |
RPMNUQRUHXIGHK-YIXRJOKQNA-N |
| InChICode |
InChI=1S/C27H30O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-8,10,18,20-30,32-36H,9H2,1H3/t10-,18-,20-,21+,22-,23-,24+,25+,26-,27+/m0/s1 |
| SMILES |
CC1O[C@@H](OC2[C@H](Oc3cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc4c3)OC(CO)[C@@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Asystasia gangetica L.  | Ref. |
| Plantae | Anacardiaceae | Rhus succedanea  | Ref. |
| Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Oleaceae | Ligustrum robustum | Ref. |
| Plantae | Oleaceae | Syringa afghanica | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana hardwickii  | Ref. |
|
|
zoom in
| Organism | Lawsonia alba | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|