| Name |
6-Hydroxyluteolin Demethylpedalitin Nornepetin 2-(3,4-Dihydroxyphenyl)-5,6,7-trihydroxy-4H-1-benzopyran-4-one |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
18003-33-3 |
| C_ID |
C00003884
, 
|
| InChIKey |
VYAKIUWQLHRZGK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-7-2-1-6(3-8(7)17)11-4-9(18)13-12(22-11)5-10(19)14(20)15(13)21/h1-5,16-17,19-21H |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Bignoniaceae | Catalpa bignonioides | Ref. |
| Plantae | Bignoniaceae | Tabebuia caraiba | Ref. |
| Plantae | Bignoniaceae | Tecoma australis | Ref. |
| Plantae | Globulariaceae | Globularia vulgaris | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Labiatae | Thymus moroderi  | Ref. |
| Plantae | Plantaginaceae | Veronica hederifolia | Ref. |
| Plantae | Plantaginaceae | Veronica triloba | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper L.  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valerianella eriocarpa  | Ref. |
| Plantae | Verbenaceae | Lippia citriodora  | Ref. |
|
|
zoom in
| Organism | Thymus moroderi | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids,(1967),41,Academic Press
Skaltsa,Planta Med.,54,(1988),465 |
|---|
|