| Name |
Rhodoxanthin |
| Formula |
C40H50O2 |
| Mw |
562.38108084 |
| CAS RN |
116-30-3 |
| C_ID |
C00003784
, 
|
| InChIKey |
VWXMLZQUDPCJPL-ZDHAIZATSA-N |
| InChICode |
InChI=1S/C40H50O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-26H,27-28H2,1-10H3/b15-11+,16-12+,19-13+,20-14+,29-17+,30-18+,31-21+,32-22+,37-23-,38-24- |
| SMILES |
CC1=CC(=O)CC(C)(C)/C1=CC=C(C)C=CC=C(C)C=CC=CC(C)=CC=CC(C)=CC=C1C(C)=CC(=O)CC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Micrococcaceae | Micrococcus tetragenus | Ref. |
| Fungi | Incertae sedis | Epicoccum spp. | Ref. |
| Plantae | -- | Lonicera ruprechtiana | Ref. |
| Plantae | Equisetaceae | Equisetum arvense  | Ref. |
| Plantae | Potamogetonaceae | Potamogeton natans | Ref. |
| Plantae | Pteridaceae | Adiantum spp. | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
|
|
zoom in
| Organism | Taxus baccata | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter60 |
|---|
|