| Name |
Harpagoside |
| Formula |
C24H30O11 |
| Mw |
494.1788118 |
| CAS RN |
19210-12-9 |
| C_ID |
C00003083
, 
|
| InChIKey |
KVRQGMOSZKPBNS-WAFLFTLGNA-N |
| InChICode |
InChI=1S/C24H30O11/c1-23(35-16(27)8-7-13-5-3-2-4-6-13)11-15(26)24(31)9-10-32-22(20(23)24)34-21-19(30)18(29)17(28)14(12-25)33-21/h2-10,14-15,17-22,25-26,28-31H,11-12H2,1H3/b8-7+/t14-,15+,17-,18-,19-,20+,21-,22-,23-,24-/m0/s1 |
| SMILES |
C[C@]1(OC(=O)/C=C/c2ccccc2)C[C@@H](O)[C@]2(O)C=CO[C@@H](O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Lamium spp. | Ref. |
| Plantae | Pedaliaceae | Harpagophytum procumbens  | Ref. |
| Plantae | Scrophulariaceae | Oreosolen wattii | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scorodonia | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|