| Name |
Procyanidin A2 Proanthocyanidin A-2 (+)-Proanthocyanidin A-2 Proanthocyanidin A2 |
| Formula |
C30H24O12 |
| Mw |
576.12677623 |
| CAS RN |
41743-41-3 |
| C_ID |
C00002934
, 
|
| InChIKey |
NSEWTSAADLNHNH-JIZSURFONA-N |
| InChICode |
InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26-,27-,29-,30+/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@@]1(c3ccc(O)c(O)c3)Oc3cc(O)c4c(c3[C@@H]2[C@H]1O)O[C@H](c1ccc(O)c(O)c1)[C@H](O)C4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Ecdysanthera utilis | Ref. |
| Plantae | Apocynaceae | Parameria laevigata MOLDENKE  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Fabaceae | Arachis hypogaea L.  | Ref. |
| Plantae | Lauraceae | Cinnamomum aromaticum  | Ref. |
| Plantae | Lauraceae | Cinnamomum spp. | Ref. |
| Plantae | Lauraceae | Persea gratissima  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Cola acuminata  | Ref. |
| Plantae | Rosaceae | Malus sylvestris  | Ref. |
| Plantae | Rosaceae | Rhaphiolepis umbellata | Ref. |
| Plantae | Rubiaceae | Pavetta owariensis  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| - | - | Cinnamomi sp. | Ref. |
|
|
zoom in
| Organism | Cinnamomum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Weinges,Ann.,715,(1968),164
Jacques,J.Chem.Soc.Perkin Trans.,1,(1974),2663 |
|---|
|