| Name |
Primin |
| Formula |
C12H16O3 |
| Mw |
208.10994438 |
| CAS RN |
15121-94-5 |
| C_ID |
C00002854
, 
|
| InChIKey |
WLWIMKWZMGJRBS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H16O3/c1-3-4-5-6-9-7-10(13)8-11(15-2)12(9)14/h7-8H,3-6H2,1-2H3 |
| SMILES |
CCCCCC1=CC(=O)C=C(OC)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Botryosphaeriaceae | Botryosphaeria mamane PSU-M76 | Ref. |
| Plantae | Melastomataceae | Miconia lepidota | Ref. |
| Plantae | Melastomataceae | Miconia spp. | Ref. |
| Plantae | Myrsinaceae | Anagallis hirtella | Ref. |
| Plantae | Myrsinaceae | Glaux maxima | Ref. |
| Plantae | Primulaceae | Dionysia aretioides | Ref. |
| Plantae | Primulaceae | Primula elatior  | Ref. |
| Plantae | Primulaceae | Primula obconica | Ref. |
|
|
zoom in
| Organism | Primula elatior | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter43 |
|---|
|