| Name |
Lucidin |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
478-08-0 |
| C_ID |
C00002838
, 
|
| InChIKey |
AMIDUPFSOUCLQB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-6-10-11(17)5-9-12(15(10)20)14(19)8-4-2-1-3-7(8)13(9)18/h1-5,16-17,20H,6H2 |
| SMILES |
O=C1c2ccccc2C(=O)c2c1cc(O)c(CO)c2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Lindera lucida | Ref. |
| Plantae | Rubiaceae | Asperula odorata  | Ref. |
| Plantae | Rubiaceae | Coelospermum reticulatum | Ref. |
| Plantae | Rubiaceae | Coprosma rotundifolia | Ref. |
| Plantae | Rubiaceae | Galium spp. | Ref. |
| Plantae | Rubiaceae | Hymenodictyon excelsum  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Morinda umbellata | Ref. |
| Plantae | Rubiaceae | Rubia tinctorum  | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
| - | - | Commitheca liebrechtsiana | Ref. |
|
|
zoom in
| Organism | Morinda citrifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|