| Name |
1,3,5-Trihydroxybenzene
Phloroglucinol |
| Formula |
C6H6O3 |
| Mw |
126.03169406 |
| CAS RN |
108-73-6 |
| C_ID |
C00002665
, 
|
| InChIKey |
QCDYQQDYXPDABM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H |
| SMILES |
Oc1cc(O)cc(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica | Ref. |
| Plantae | Caryophyllaceae | Lychnis dioica | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Euphorbiaceae | Mallotus philippinensis | Ref. |
| Plantae | Fabaceae | Acacia arabica | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
| Plantae | Rosaceae | Malus pumila | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Taxodiaceae | Sequoia gigantea | Ref. |
| Plantae | Taxodiaceae | Sequoia sempervirens | Ref. |
| Plantae | Zingiberaceae | Alpinia blepharocalyx | Ref. |
| - | - | Alliun cepa | Ref. |
| - | - | Sergassum spinuligerum | Ref. |
|
|
zoom in
| Organism | Polygonum bistorta |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
