| Name |
Catechol Pyrocatechin Pyrocatechol |
| Formula |
C6H6O2 |
| Mw |
110.03677944 |
| CAS RN |
120-80-9 |
| C_ID |
C00002644
, 
|
| InChIKey |
YCIMNLLNPGFGHC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| SMILES |
Oc1ccccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
| Plantae | Asteraceae | Conyza bonariensis  | Ref. |
| Plantae | Asteraceae | Erigeron breviscapus  | Ref. |
| Plantae | Betulaceae | Betula luminifera | Ref. |
| Plantae | Cercidiphyllaceae | Cercidiphyllum japonicum var.sinense | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Cucurbitaceae | Luffa cylindrica  | Ref. |
| Plantae | Ericaceae | Gaultheria spp. | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Illiciaceae | Illicium fargesii | Ref. |
| Plantae | Lauraceae | Persea americana  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Nelumbonaceae | Nelumbo nucifera  | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Passifloraceae | Passiflora caerulea  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rubiaceae | Uncaria gambir  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Terminalia chebula | | Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|