| Name |
Sumatrol |
| Formula |
C23H22O7 |
| Mw |
410.13655306 |
| CAS RN |
82-10-0 |
| C_ID |
C00002575
, 
|
| InChIKey |
ZPEHYKMRUBEPSQ-GKXZKTCUNA-N |
| InChICode |
InChI=1S/C23H22O7/c1-10(2)14-6-12-16(29-14)7-13(24)21-22(25)20-11-5-17(26-3)18(27-4)8-15(11)28-9-19(20)30-23(12)21/h5,7-8,14,19-20,24H,1,6,9H2,2-4H3/t14-,19-,20+/m1/s1 |
| SMILES |
C=C(C)[C@H]1Cc2c(cc(O)c3c2O[C@@H]2COc4cc(OC)c(OC)cc4[C@@H]2C3=O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Crotalaria burha | Ref. |
| Plantae | Fabaceae | Crotalaria burhia  | Ref. |
| Plantae | Fabaceae | Derris malaccensis | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Millettia auriculata  | Ref. |
| Plantae | Fabaceae | Piscidia erythrina | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
|
|
zoom in
| Organism | Tephrosia toxicaria | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Kenny,J.Chem.Soc.,(1939),1601
Falshaw,Tetrahedron (Suppl.7),(1966),333 |
|---|
|