| Name |
Lasiocarpine |
| Formula |
C21H33NO7 |
| Mw |
411.22570242 |
| CAS RN |
303-34-4 |
| C_ID |
C00002097
, 
|
| InChIKey |
QHOZSLCIKHUPSU-WMZRPMCLNA-N |
| InChICode |
InChI=1S/C21H33NO7/c1-7-13(2)18(23)29-16-9-11-22-10-8-15(17(16)22)12-28-19(24)21(26,14(3)27-6)20(4,5)25/h7-8,14,16-17,25-26H,9-12H2,1-6H3/b13-7-/t14-,16+,17-,21+/m1/s1 |
| SMILES |
C/C=C(/C)C(=O)O[C@H]1CCN2CC=C(COC(=O)[C@@](O)([C@@H](C)OC)C(C)(C)O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio oryzetorum | Ref. |
| Plantae | Boraginaceae | Cynoglossum officinale  | Ref. |
| Plantae | Boraginaceae | Heliotropium arbainense | Ref. |
| Plantae | Boraginaceae | Heliotropium arborescens | Ref. |
| Plantae | Boraginaceae | Heliotropium bacciferum  | Ref. |
| Plantae | Boraginaceae | Heliotropium bovei | Ref. |
| Plantae | Boraginaceae | Heliotropium circinatum | Ref. |
| Plantae | Boraginaceae | Heliotropium curassavicum | Ref. |
| Plantae | Boraginaceae | Heliotropium eichwaldii | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutissimum | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutum | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Boraginaceae | Heliotropium lasiocarpum | Ref. |
| Plantae | Boraginaceae | Heliotropium olgae | Ref. |
| Plantae | Boraginaceae | Heliotropium rotundifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium supinum | Ref. |
| Plantae | Boraginaceae | Lappula intermedia | Ref. |
| Plantae | Boraginaceae | Symphytum asperum | Ref. |
| Plantae | Boraginaceae | Symphytum caucasicum | Ref. |
| Plantae | Boraginaceae | Symphytum caucasium | Ref. |
| Plantae | Boraginaceae | Symphytum officinale  | Ref. |
| Plantae | Boraginaceae | Symphytum officinalis | Ref. |
| - | - | Heliotorpium digynum | Ref. |
|
|
zoom in
| Organism | Heliotropium circinatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|