| Name |
Sinalbin |
| Formula |
C14H19NO10S2 |
| Mw |
425.0450373 |
| CAS RN |
20196-67-2 |
| C_ID |
C00001487
, 
|
| InChIKey |
WWBNBPSEKLOHJU-QOGWPGSMNA-N |
| InChICode |
InChI=1S/C14H19NO10S2/c16-6-9-11(18)12(19)13(20)14(24-9)26-10(15-25-27(21,22)23)5-7-1-3-8(17)4-2-7/h1-4,9,11-14,16-20H,5-6H2,(H,21,22,23)/b15-10+/t9-,11-,12+,13+,14+/m1/s1 |
| SMILES |
O=S(=O)(O)O/N=C(Cc1ccc(O)cc1)S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cruciferae | Sinapis alba  | Ref. |
| Plantae | Cruciferae | Sinapis arvensis  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
|
|
zoom in
| Organism | Moringa stenopetala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|