| Name |
Malonic acid |
| Formula |
C3H4O4 |
| Mw |
104.01095862 |
| CAS RN |
141-82-2 |
| C_ID |
C00001193
, 
|
| InChIKey |
OFOBLEOULBTSOW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7) |
| SMILES |
O=C(O)CC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Gynostemma pentaphyllum  | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Poaceae | Hordeum vulgare  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Gynostemma pentaphyllum | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|