| Name |
Tambulin |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
571-72-2 |
| C_ID |
C00001104
, 
|
| InChIKey |
KAPZSMYEZDLAFB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-10-6-4-9(5-7-10)16-15(21)14(20)13-11(19)8-12(23-2)17(24-3)18(13)25-16/h4-8,19,21H,1-3H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(OC)cc(O)c3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Ozothamnus expansifolius | Ref. |
| Plantae | Asteraceae | Ozothamnus obcordatus | Ref. |
| Plantae | Asteraceae | Rudbeckia bicolor | Ref. |
| Plantae | Calceolariaceae | Calceolaria irazeunsis | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
| Plantae | Rutaceae | Drummondita calida | Ref. |
| Plantae | Rutaceae | Zanthoxylum acanthopodium  | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
|
|
zoom in
| Organism | Drummondita calida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Balakrishna,Proc.Indian Acad.Sci.Sect.A,26,(1947),214
Balakrishna,Proc.Indian Acad.Sci.Sect A.,26(1947),296 |
|---|
|