| Name |
Pinobanksin |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
548-82-3 |
| C_ID |
C00000991
, 
|
| InChIKey |
SUYJZKRQHBQNCA-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2O[C@H](c2ccccc2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Akaniaceae | Bretschneidera sinensis | Ref. |
| Plantae | Asteraceae | Baccharis bigelovii | Ref. |
| Plantae | Asteraceae | Baccharis oxydonta | Ref. |
| Plantae | Asteraceae | Chromolaena chasleae | Ref. |
| Plantae | Asteraceae | Flourensia riparia Grisebach | Ref. |
| Plantae | Asteraceae | Helichrysum tenuifolium | Ref. |
| Plantae | Asteraceae | Lychnophora diamantinana | Ref. |
| Plantae | Betulaceae | Alnus sieboldiana | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Malvaceae | Tilia platyphyllos  | Ref. |
| Plantae | Myoporaceae | Eremophila alternifolia  | Ref. |
| Plantae | Myoporaceae | Eremophila spp.  | Ref. |
| Plantae | Orchidaceae | Bulbophyllum odoratissimum | Ref. |
| Plantae | Pinaceae | Larix dahurica | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Platanaceae | Platanus vulgaris | Ref. |
| Plantae | Polygonaceae | Polygonum nodosum | Ref. |
| Plantae | Salicaceae | Populus deltoides | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Lychnophora diamantinana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 662,Flavanones and dihydroflavonols
Lindstedt,Acta Chem.Scand.,5,(1951),121
Majumder,Phytochem.,30,(1991),2092 |
|---|
|