| Name |
d-Sabinene (+)-Sabinene |
| Formula |
C10H16 |
| Mw |
136.12520051 |
| CAS RN |
2009-00-9 |
| C_ID |
C00000857
, 
|
| InChIKey |
NDVASEGYNIMXJL-WSYQHHSTNA-N |
| InChICode |
InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3/t9-,10-/m1/s1 |
| SMILES |
C=C1CC[C@]2(C(C)C)C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Cupressaceae | Juniperus sabina  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Myristicaceae | Myristica fragrans  | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|