| Name |
Nordihydroguaiaretic acid |
| Formula |
C18H22O4 |
| Mw |
302.15180919 |
| CAS RN |
500-38-9 |
| C_ID |
C00000693
, 
|
| InChIKey |
HCZKYJDFEPMADG-TXEJJXNPNA-N |
| InChICode |
InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+ |
| SMILES |
C[C@H](Cc1ccc(O)c(O)c1)[C@@H](C)Cc1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Zygophyllaceae | Guaiacum officinale  | Ref. |
| Plantae | Zygophyllaceae | Guaiacum sanctum | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea spp. | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
| - | - | Guajacum officinale | Ref. |
|
|
zoom in
| Organism | Guajacum officinale | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Sakurai, et al., Chem Pharm Bull, 40, (1992), 1191 |
|---|
|