| Name |
Dihydrodehydrodiconiferyl alcohol Lawsonicin |
| Formula |
C20H24O6 |
| Mw |
360.1572885 |
| CAS RN |
85165-02-2 |
| C_ID |
C00000672
, 
|
| InChIKey |
SBLZVJIHPWRSQQ-ZTKWPLJKNA-N |
| InChICode |
InChI=1S/C20H24O6/c1-24-17-10-13(5-6-16(17)23)19-15(11-22)14-8-12(4-3-7-21)9-18(25-2)20(14)26-19/h5-6,8-10,15,19,21-23H,3-4,7,11H2,1-2H3/t15-,19+/m0/s1 |
| SMILES |
COc1cc([C@H]2Oc3c(OC)cc(CCCO)cc3[C@@H]2CO)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Acanthopanax senticosus  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Malvaceae | Helicteres angustifolia  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Rubiaceae | Mitragyna africanus | Ref. |
| Plantae | Santalaceae | Santalum album L.  | Ref. |
|
|
zoom in
| Organism | Mitragyna africanus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|