| Name |
(-)-5-Methoxypodophyllotoxin 5-Methoxy-4-epipodophyllotoxin 6-Methoxypodophyllotoxin 6-Mmethoxypodophyllotoxin |
| Formula |
C23H24O9 |
| Mw |
444.14203237 |
| CAS RN |
128443-52-7 |
| C_ID |
C00000654
, 
|
| InChIKey |
PDQAOYGENRRPQO-LAWDLWGNNA-N |
| InChICode |
InChI=1S/C23H24O9/c1-26-13-5-10(6-14(27-2)20(13)28-3)16-11-7-15-21(32-9-31-15)22(29-4)18(11)19(24)12-8-30-23(25)17(12)16/h5-7,12,16-17,19,24H,8-9H2,1-4H3/t12-,16+,17-,19+/m0/s1 |
| SMILES |
COc1cc([C@@H]2c3cc4c(c(OC)c3[C@H](O)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum  | Ref. |
| Plantae | Cupressaceae | Libocedrus chevalieri | Ref. |
| Plantae | Linaceae | Linum album | Ref. |
| Plantae | Linaceae | Linum cariense | Ref. |
| Plantae | Linaceae | Linum flavum | Ref. |
| Plantae | Linaceae | Linum scabrellum | Ref. |
|
|
zoom in
| Organism | Linum scabrellum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|