| Name |
(S)-Isoboldine Isoboldine (+)-Isoboldine |
| Formula |
C19H21NO4 |
| Mw |
327.14705817 |
| CAS RN |
3019-51-0 |
| C_ID |
C00001869
, 
|
| InChIKey |
LINHZVMHXABQLB-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C19H21NO4/c1-20-5-4-10-8-16(24-3)19(22)18-12-9-15(23-2)14(21)7-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)C[C@H]1c3c(cc(OC)c(O)c3-2)CCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimolia | Ref. |
| Plantae | Annonaceae | Annona senegalensis  | Ref. |
| Plantae | Annonaceae | Anomianthus dulcis  | Ref. |
| Plantae | Annonaceae | Anonna salzmanii | Ref. |
| Plantae | Annonaceae | Cardiopetalum calophyllum | Ref. |
| Plantae | Annonaceae | Guatteria goudotiana | Ref. |
| Plantae | Annonaceae | Xylopia danguyella | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Annonaceae | Xylopia vieillardi | Ref. |
| Plantae | Berberidaceae | Berberis brandisiana | Ref. |
| Plantae | Berberidaceae | Nandina domestica  | Ref. |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Euphorbiaceae | Croton celtidifolius | Ref. |
| Plantae | Euphorbiaceae | Croton lechleri Mull.Arg.  | Ref. |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fumariaceae | Ceratocapnos palaestinus | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis caucasia | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis gortschakovii | Ref. |
| Plantae | Fumariaceae | Corydalis intermedia | Ref. |
| Plantae | Fumariaceae | Corydalis nobilis | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Fumaria agraria | Ref. |
| Plantae | Fumariaceae | Fumaria bella | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Lauraceae | Aniba canelilla  | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Lauraceae | Cryptocarya chinensis | Ref. |
| Plantae | Lauraceae | Dehaasia triandra | Ref. |
| Plantae | Lauraceae | Lindera glauca | Ref. |
| Plantae | Lauraceae | Litsea acuminata | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lauraceae | Litsea glutinosa  | Ref. |
| Plantae | Lauraceae | Nectandra grandiflora | Ref. |
| Plantae | Lauraceae | Nectandra membranacea | Ref. |
| Plantae | Lauraceae | Nectandra salicifolia | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Ocotea caesia | Ref. |
| Plantae | Lauraceae | Phoebe minutiflora | Ref. |
| Plantae | Menispermaceae | Cocculus laurifolius | Ref. |
| Plantae | Menispermaceae | Pachygone dasycarpa | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha  | Ref. |
| Plantae | Menispermaceae | Stephania excentrica | Ref. |
| Plantae | Menispermaceae | Stephania officinarum | Ref. |
| Plantae | Monimiaceae | Peumus boldus  | Ref. |
| Plantae | Papaveraceae | Glaucium arabicum | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Papaveraceae | Glaucium grandiflorum | Ref. |
| Plantae | Papaveraceae | Papaver orientale  | Ref. |
| Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
| Plantae | Papaveraceae | Papaver rhoeas  | Ref. |
| Plantae | Papaveraceae | Papaver setigerum | Ref. |
| Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
| Plantae | Ranunculaceae | Aconitum karacolicum | Ref. |
| Plantae | Ranunculaceae | Aconitum saposhnikovii | Ref. |
| Plantae | Ranunculaceae | Thalictrum collinum | Ref. |
| Plantae | Ranunculaceae | Thalictrum foetidum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
|
|
zoom in
| Organism | Thalictrum foetidum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
LIN, et al., Chem Pharm Bull, 49, (2001), 1292 |
|---|
|