| Name |
Cinaroside Cynaroside Luteolin 7-glucoside Luteolin 7-O-beta-D-glucopyranoside Luteolin 7-O-beta-D-glucoside Luteolin 7-O-beta-glucopyranoside Luteolin 7-O-beta-glucoside Luteolin 7-O-glucoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
5373-11-5 |
| C_ID |
C00004266
, 
|
| InChIKey |
PEFNSGRTCBGNAN-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
| Plantae | Asteraceae | Achyrocline satureioides  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Chrysanthemum indicum  | Ref. |
| Plantae | Asteraceae | Chrysanthemum morifolium  | Ref. |
| Plantae | Asteraceae | Gnaphalium affine  | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Helichrysum graveolen | Ref. |
| Plantae | Asteraceae | Lactuca indica  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Onopordum acanthium  | Ref. |
| Plantae | Asteraceae | Santolina chamaecyperissus | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Asteraceae | Tessaria dodoneifolia | Ref. |
| Plantae | Asteraceae | Thelesperma megapotamicum  | Ref. |
| Plantae | Betulaceae | Betula nigra  | Ref. |
| Plantae | Bromeliaceae | Aechmea glomerata | Ref. |
| Plantae | Cannabaceae | Humulus japonicus | Ref. |
| Plantae | Caryophyllaceae | Melandrium album  | Ref. |
| Plantae | Colchicaceae | Wurmbea dioica F.Muell. | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Fabaceae | Acacia caven  | Ref. |
| Plantae | Fabaceae | Acacia furcatispina | Ref. |
| Plantae | Fabaceae | Ammothamnus lehmanni Bge. | Ref. |
| Plantae | Fabaceae | Cassia tora  | Ref. |
| Plantae | Fabaceae | Hymenaea palustris Ducke | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Gentianaceae | Gentiana argentea | Ref. |
| Plantae | Gentianaceae | Gentiana depressa | Ref. |
| Plantae | Gentianaceae | Gentiana elwesii | Ref. |
| Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
| Plantae | Gentianaceae | Gentiana prolata | Ref. |
| Plantae | Gentianaceae | Gentiana sikkimensis | Ref. |
| Plantae | Jubulaceae | Frullania dilatata | Ref. |
| Plantae | Jubulaceae | Frullania tamarisci | Ref. |
| Plantae | Labiatae | Dracocephalum rupestre | Ref. |
| Plantae | Labiatae | Mentha aquatica L.  | Ref. |
| Plantae | Labiatae | Mentha piperitae | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
| Plantae | Labiatae | Prunella vulgaris  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Schizonepeta tenuifolia  | Ref. |
| Plantae | Labiatae | Scutellaria oreophila | Ref. |
| Plantae | Labiatae | Thymus austriacus | Ref. |
| Plantae | Labiatae | Thymus citriodorus  | Ref. |
| Plantae | Labiatae | Thymus longicaulis  | Ref. |
| Plantae | Labiatae | Thymus membranaceus | Ref. |
| Plantae | Labiatae | Thymus numidicus | Ref. |
| Plantae | Labiatae | Thymus oblongifolius | Ref. |
| Plantae | Labiatae | Thymus praecox  | Ref. |
| Plantae | Labiatae | Thymus pulegioides  | Ref. |
| Plantae | Labiatae | Thymus serpyllum  | Ref. |
| Plantae | Labiatae | Thymus sibthorpii | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Sida galheirensis | Ref. |
| Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
| Plantae | Plantaginaceae | Plantago argentea | Ref. |
| Plantae | Plantaginaceae | Plantago holosteum | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago maritima  | Ref. |
| Plantae | Plantaginaceae | Veronica fuhsii | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica peregrina L.  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Plantaginaceae | Veronicastrum sibiricum | Ref. |
| Plantae | Plantaginaceae | Veronica thymoides ssp.pseudocinerea | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Ricciaceae | Riccia fluitans L | Ref. |
| Plantae | Rosaceae | Agrimonia pilosa var.japonica  | Ref. |
| Plantae | Rosaceae | Spiraea hypericifolia | Ref. |
| Plantae | Rubiaceae | Morinda morindoides | Ref. |
| Plantae | Salicaceae | Salix babylonica  | Ref. |
| Plantae | Salicaceae | Salix cheilophila | Ref. |
| Plantae | Salicaceae | Salix matsudana | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana chionophila | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana fedtschenkoi | Ref. |
| Plantae | Verbenaceae | Clerodendron serratum  | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| - | - | Echinop ritro | Ref. |
| - | - | Traxacum officinale  | Ref. |
|
|
zoom in
| Organism | Thymus longicaulis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|