| Name |
Myrtillin Delphinidin 3-O-beta-D-glucopyranoside |
| Formula |
C21H21O12.Cl |
| Mw |
500.07215385 |
| CAS RN |
6906-38-3 |
| C_ID |
C00006698
, 
|
| InChIKey |
XENHPQQLDPAYIJ-ABIWRIGZNA-O |
| InChICode |
InChI=1S/C21H20O12/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27)/p+1/t15-,17-,18+,19-,21-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Balsaminaceae | Impatiens balsamina  | Ref. |
| Plantae | Boraginaceae | Lobostemon spp. | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Ericaceae | Vaccinium myrtillus L.  | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Mucuna sempervirens | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vigna spp. | Ref. |
| Plantae | Geraniaceae | Geranium sylvaticum | Ref. |
| Plantae | Grossulariaceae | Ribes nigrum  | Ref. |
| Plantae | Hyacinthaceae | Muscari armeniacum  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea macrophylla  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Muntingiaceae | Muntingia calabura  | Ref. |
| Plantae | Myrsinaceae | Ardisia humilis | Ref. |
| Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
| Plantae | Myrtaceae | Metrosideros spp. | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Passifloraceae | Passiflora suberosa | Ref. |
| Plantae | Pinaceae | Abies spp. | Ref. |
| Plantae | Pinaceae | Picea spp. | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Pinaceae | Pseudotsuga spp. | Ref. |
| Plantae | Pinaceae | Tsuga spp. | Ref. |
| Plantae | Plumbaginaceae | Limonium spp. | Ref. |
| Plantae | Plumbaginaceae | Plumbago spp. | Ref. |
| Plantae | Poaceae | Alopecurus spp. | Ref. |
| Plantae | Poaceae | Anthoxanthum spp. | Ref. |
| Plantae | Poaceae | Avenula spp. | Ref. |
| Plantae | Poaceae | Bothriochloa spp. | Ref. |
| Plantae | Poaceae | Dactylis spp. | Ref. |
| Plantae | Poaceae | Deschampsia spp. | Ref. |
| Plantae | Poaceae | Elymus spp. | Ref. |
| Plantae | Poaceae | Festuca spp. | Ref. |
| Plantae | Poaceae | Hordeum spp. | Ref. |
| Plantae | Poaceae | Miscanthus spp. | Ref. |
| Plantae | Poaceae | Molinia spp. | Ref. |
| Plantae | Poaceae | Oryza spp. | Ref. |
| Plantae | Poaceae | Phalaris spp. | Ref. |
| Plantae | Poaceae | Phleum spp. | Ref. |
| Plantae | Poaceae | Poa spp. | Ref. |
| Plantae | Poaceae | Sinarundinaria spp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
| Plantae | Polygonaceae | Polygonum spp. | Ref. |
| Plantae | Salicaceae | Salix spp. | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Ternstroemiaceae | Visnea mocanera | Ref. |
| Plantae | Verbenaceae | Verbena x hybrida | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis vinifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Karrer,Helv.Chim.Acta,16,(1933),292
Reynolds,J.Chem.Soc.,(1934),1039 |
|---|
|