| Name |
(E)-Piceid Piceid Resveratrol 3-O-beta-glucopyranoside 3,3',4,5'-Tetrahydroxystilbene 3-O-beta-D-glucopyranoside |
| Formula |
C20H22O8 |
| Mw |
390.13146768 |
| CAS RN |
27208-80-6 |
| C_ID |
C00002896
, 
|
| InChIKey |
HSTZMXCBWJGKHG-UAIPQYJBNA-N |
| InChICode |
InChI=1S/C20H22O8/c21-10-16-17(24)18(25)19(26)20(28-16)27-15-8-12(7-14(23)9-15)2-1-11-3-5-13(22)6-4-11/h1-9,16-26H,10H2/b2-1+/t16-,17+,18+,19-,20-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc(O)cc(/C=C/c3ccc(O)cc3)c2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Dipterocarpaceae | Upuna borneensis | Ref. |
| Plantae | Dipterocarpaceae | Vatica rassak | Ref. |
| Plantae | Ericaceae | Loiseleuria procumbens (L.) Desv. | Ref. |
| Plantae | Fabaceae | Lysidice brevicalyx Wei | Ref. |
| Plantae | Fabaceae | Lysidice rhodostegia | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Melanthiaceae | Schoenocaulon officinale | Ref. |
| Plantae | Melanthiaceae | Veratrum grandiflorum | Ref. |
| Plantae | Myrtaceae | Angophora cordifolia | Ref. |
| Plantae | Myrtaceae | Corymbia haematoxylon | Ref. |
| Plantae | Myrtaceae | Corymbia papuana | Ref. |
| Plantae | Myrtaceae | Corymbia tessellaris | Ref. |
| Plantae | Myrtaceae | Eucalyptus abergiana | Ref. |
| Plantae | Myrtaceae | Eucalyptus astringens | Ref. |
| Plantae | Myrtaceae | Eucalyptus caesia | Ref. |
| Plantae | Myrtaceae | Eucalyptus calophylla | Ref. |
| Plantae | Myrtaceae | Eucalyptus campospe | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eucalyptus decorticans | Ref. |
| Plantae | Myrtaceae | Eucalyptus dichromophloia  | Ref. |
| Plantae | Myrtaceae | Eucalyptus eremophila | Ref. |
| Plantae | Myrtaceae | Eucalyptus erythrophloia | Ref. |
| Plantae | Myrtaceae | Eucalyptus ficifolia | Ref. |
| Plantae | Myrtaceae | Eucalyptus gardneri | Ref. |
| Plantae | Myrtaceae | Eucalyptus griffithsii | Ref. |
| Plantae | Myrtaceae | Eucalyptus grossa | Ref. |
| Plantae | Myrtaceae | Eucalyptus gummifera  | Ref. |
| Plantae | Myrtaceae | Eucalyptus intermedia | Ref. |
| Plantae | Myrtaceae | Eucalyptus maculata | Ref. |
| Plantae | Myrtaceae | Eucalyptus melonophlo | Ref. |
| Plantae | Myrtaceae | Eucalyptus nowraensis | Ref. |
| Plantae | Myrtaceae | Eucalyptus occidentalis | Ref. |
| Plantae | Myrtaceae | Eucalyptus polycarpa  | Ref. |
| Plantae | Myrtaceae | Eucalyptus pruinosa | Ref. |
| Plantae | Myrtaceae | Eucalyptus sargentii | Ref. |
| Plantae | Myrtaceae | Eucalyptus sideroxylon | Ref. |
| Plantae | Myrtaceae | Eucalyptus spathulata | Ref. |
| Plantae | Myrtaceae | Eucalyptus stricklandii | Ref. |
| Plantae | Myrtaceae | Eucalyptus terminalis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus trachyphloia | Ref. |
| Plantae | Myrtaceae | Eucalyptus wandoo | Ref. |
| Plantae | Myrtaceae | Eucalyptus woodwardii | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea glehnii | Ref. |
| Plantae | Pinaceae | Picea jezoensis | Ref. |
| Plantae | Pinaceae | Picea koraiensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Picea sitchensis  | Ref. |
| Plantae | Poaceae | Sorghum bicolor  | Ref. |
| Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum  | Ref. |
| Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
| Plantae | Polygonaceae | Rheum palmatum  | Ref. |
| Plantae | Polygonaceae | Rheum tanguticum  | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata var hancei  | Ref. |
| Plantae | Vitaceae | Vitis rupestris | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | Pleuropterus ciliinervis | Ref. |
|
|
zoom in
| Organism | Polygonum sachalinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|