| Name |
Chrysoeriol Luteolin 3'-methyl ether |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
491-71-4 |
| C_ID |
C00001029
, 
|
| InChIKey |
SCZVLDHREVKTSH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-7,17-19H,1H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Onopordum acanthium  | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium (L.) Schulz Bip.  | Ref. |
| Plantae | Asteraceae | Tanacetum vulgare L.  | Ref. |
| Plantae | Bignoniaceae | Newbouldia laevis  | Ref. |
| Plantae | Cannabaceae | Cannabis indica | Ref. |
| Plantae | Cannabaceae | Cannabis sativa L.  | Ref. |
| Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Fabaceae | Arachis hypogaea  | Ref. |
| Plantae | Fabaceae | Bauhinia guianensis  | Ref. |
| Plantae | Fabaceae | Cadia purpurea | Ref. |
| Plantae | Fabaceae | Cassia alata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Hymenaea palustris Ducke | Ref. |
| Plantae | Fabaceae | Lotus maritimus | Ref. |
| Plantae | Fabaceae | Medicago intertexta | Ref. |
| Plantae | Fabaceae | Medicago marina | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Parkinsonia aculeata  | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
| Plantae | Fabaceae | Thermopsis alterniflora | Ref. |
| Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
| Plantae | Fabaceae | Thermopsis mollis | Ref. |
| Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
| Plantae | Fabaceae | Thermopsis villosa | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hydrocharitaceae | Halophila stipulacea | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon glutinosum | Ref. |
| Plantae | Labiatae | Leucas aspera  | Ref. |
| Plantae | Labiatae | Marrubium velutinum | Ref. |
| Plantae | Labiatae | Origanum majoricum | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Salvia candidissima | Ref. |
| Plantae | Labiatae | Salvia dorrii | Ref. |
| Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
| Plantae | Labiatae | Salvia mirzayana | Ref. |
| Plantae | Labiatae | Salvia palaestina | Ref. |
| Plantae | Lamiaceae | Coleus amboinicus  | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Myoporaceae | Myoporum bontioides | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
| Plantae | Plantaginaceae | Veronica hederifolia | Ref. |
| Plantae | Plantaginaceae | Veronica triloba | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Zea mays L.  | Ref. |
| Plantae | Pteridaceae | Notholaena californica | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Salicaceae | Salix babylonica  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
| - | - | Echinop ritro | Ref. |
| - | - | Riella affinis | Ref. |
| - | - | Riella americana | Ref. |
|
|
zoom in
| Organism | Veronica triloba | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|