| Name |
Myricitrin
Myricetin 3-O-alpha-L-rhamnopyranoside
Myricetin 3-O-alpha-L-rhamnoside
Myricetin 3-O-rhamnoside
Myricetin 3-rhamnoside
Myricetin-3-O-alpha-L-rhamnoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
17912-87-7 |
| C_ID |
C00005730
, 
|
| InChIKey |
DCYOADKBABEMIQ-OWMUPTOHSA-N |
| InChICode |
InChI=1S/C21H20O12/c1-6-14(26)17(29)18(30)21(31-6)33-20-16(28)13-9(23)4-8(22)5-12(13)32-19(20)7-2-10(24)15(27)11(25)3-7/h2-6,14,17-18,21-27,29-30H,1H3/t6-,14-,17+,18+,21-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3cc(O)c(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Pistacia weinmannifolia J.Pisson ex.Franch  | Ref. |
| Plantae | Anacardiaceae | Rhus parviflora | Ref. |
| Plantae | Asteraceae | Haplopappus bailahuen | Ref. |
| Plantae | Canellaceae | Warburgia stuhlmannii | Ref. |
| Plantae | Caricaceae | Carica papaya | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Crassulaceae | Bryophyllum pinnatum | Ref. |
| Plantae | Crassulaceae | Sedum kamtschaticum | Ref. |
| Plantae | Cunoniaceae | Davidsonia pruriens | Ref. |
| Plantae | Cupressaceae | Thuja orientalis | Ref. |
| Plantae | Dilleniaceae | Doliocarpus spraguei | Ref. |
| Plantae | Ebenaceae | Diospyros kaki | Ref. |
| Plantae | Fabaceae | Acacia aroma | Ref. |
| Plantae | Fabaceae | Acacia saligna | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima | Ref. |
| Plantae | Fabaceae | Caragana jubata | Ref. |
| Plantae | Fabaceae | Desmanthus illinoensis | Ref. |
| Plantae | Fabaceae | Flemingia congesta | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Fagaceae | Quercus rubra | Ref. |
| Plantae | Iridaceae | Patersonia spp. | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Juglandaceae | Juglans nigra | Ref. |
| Plantae | Leeaceae | Leea thorelii Gagnep | Ref. |
| Plantae | Myricaceae | Myrica rubra | Ref. |
| Plantae | Myrsinaceae | Ardisia japonica | Ref. |
| Plantae | Myrsinaceae | Lysimachia spp. | Ref. |
| Plantae | Myrtaceae | Eugenia edulis | Ref. |
| Plantae | Myrtaceae | Luma chequen | Ref. |
| Plantae | Myrtaceae | Myrtus communis | Ref. |
| Plantae | Myrtaceae | Plinia pinnata | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Nymphaeaceae | Nymphaea lotus | Ref. |
| Plantae | Nymphaeaceae | Nymphaea odorata | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus acidus | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Plumbaginaceae | Armeria sp. | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
| Plantae | Plumbaginaceae | Limonium spp. | Ref. |
| Plantae | Polygalaceae | Polygala chinensis | Ref. |
| Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
| Plantae | Restionaceae | Chondropetalum spp. | Ref. |
| Plantae | Restionaceae | Elegia capensis | Ref. |
| Plantae | Sapotaceae | Diploknema butyracea | Ref. |
| Plantae | Sapotaceae | Manilkara zapota cv.Tikal | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
| Plantae | Saxifragaceae | Heuchera spp. | Ref. |
| Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
| Plantae | Saxifragaceae | Rodgersia podophylla | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum | Ref. |
| Plantae | Taxodiaceae | Metasequoia glyptostroboides | Ref. |
| Plantae | Vitaceae | Ampelopsis grossedentata | Ref. |
| Plantae | Zingiberaceae | Hedychium spp. | Ref. |
| - | - | Peltiphyllum peltatum | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
|
|
zoom in
| Organism | Rodgersia podophylla |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Yuan, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 359.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Khabir, et al., Chem Abstr, 104, (1986), 48734k.
MATSUDA, et al., Chem Pharm Bull, 50, (2002), 208.
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
Chin, et al., Planta Med, 70, (2004), 576.
Kuo, et al., Planta Med, 70, (2004), 1237 |
|---|
|
