| Name |
5,4'-Dihydroxy-7-methoxyflavone Genkwanin |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
437-64-9 |
| C_ID |
C00001043
, 
|
| InChIKey |
JPMYFOBNRRGFNO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina pichinchensis | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Fabaceae | Acacia constricta | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Medicago polymorpha  | Ref. |
| Plantae | Fabaceae | Mimosa hostilis | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Hydrocharitaceae | Halophila stipulacea | Ref. |
| Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton  | Ref. |
| Plantae | Labiatae | Ocimum basilicum L.  | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicum L.  | Ref. |
| Plantae | Labiatae | Ocimum selloi Benth.  | Ref. |
| Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum intercedens | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Plectranthus fruticosus | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia dorrii | Ref. |
| Plantae | Labiatae | Salvia glutinosa  | Ref. |
| Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
| Plantae | Labiatae | Salvia lavandulifolia  | Ref. |
| Plantae | Labiatae | Salvia microsiphon | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia palaestina | Ref. |
| Plantae | Labiatae | Salvia sapinae | Ref. |
| Plantae | Labiatae | Salvia stenophylla  | Ref. |
| Plantae | Labiatae | Salvia yosgadensis | Ref. |
| Plantae | Labiatae | Teucrium ramosissimum | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Menispermaceae | Tinospora crispa  | Ref. |
| Plantae | Pteridaceae | Cheilanthes albomarginata  | Ref. |
| Plantae | Pteridaceae | Cheilanthes rufa | Ref. |
| Plantae | Thymelaeaceae | Daphne genkwa  | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
| - | - | Syphopappus polystachyus | Ref. |
|
|
zoom in
| Organism | Larrea tridentata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harbone, Comparative Biochemisty of the Flavonoids,(1965),39, Academic Press
Sakakibara,Phytochem.,15,(1976),727 |
|---|
|