| Name |
(+)-Lariciresinol Lariciresinol |
| Formula |
C20H24O6 |
| Mw |
360.1572885 |
| CAS RN |
27003-73-2 |
| C_ID |
C00000602
, 
|
| InChIKey |
MHXCIKYXNYCMHY-KICIYKGHNA-N |
| InChICode |
InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m0/s1 |
| SMILES |
COc1cc(C[C@H]2CO[C@H](c3ccc(O)c(OC)c3)[C@H]2CO)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterococcaceae | Enterococcus faecalis  | Ref. |
| Plantae | Acanthaceae | Justicia diffusa var. prostrata | Ref. |
| Plantae | Acanthaceae | Justicia glauca | Ref. |
| Plantae | Acanthaceae | Justicia tranquebariensis  | Ref. |
| Plantae | Adoxaceae | Sambucus nigra  | Ref. |
| Plantae | Apocynaceae | Parsonsia laevigata  | Ref. |
| Plantae | Araceae | Arum italicum  | Ref. |
| Plantae | Araucariaceae | Araucaria angustifolia | Ref. |
| Plantae | Asteraceae | Carduus assoi | Ref. |
| Plantae | Balanophoraceae | Balanophora harlandii | Ref. |
| Plantae | Dipsacaceae | Morina chinensis  | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Fabaceae | Prosopis juliflora  | Ref. |
| Plantae | Gentianaceae | Fagraea racemosa | Ref. |
| Plantae | Labiatae | Clerodendrum indicum  | Ref. |
| Plantae | Labiatae | Nepeta cadmea | Ref. |
| Plantae | Labiatae | Perovskia atriplicifolia | Ref. |
| Plantae | Labiatae | Phlomis spinidens | Ref. |
| Plantae | Labiatae | Premna resinosa  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia coco | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia kobus  | Ref. |
| Plantae | Malvaceae | Hibiscus cannabinus  | Ref. |
| Plantae | Meliaceae | Aglaia elaeagnoidea | Ref. |
| Plantae | Oleaceae | Forsythia intermedia | Ref. |
| Plantae | Oleaceae | Jasminum hemsleyi | Ref. |
| Plantae | Oleaceae | Osmanthus asiaticus | Ref. |
| Plantae | Oleaceae | Syringa vulgaris  | Ref. |
| Plantae | Orobanchaceae | Pedicularis artselaeri | Ref. |
| Plantae | Pinaceae | Abies sachalinensis | Ref. |
| Plantae | Pinaceae | Cedrus deodara  | Ref. |
| Plantae | Pinaceae | Larix dahurica | Ref. |
| Plantae | Pinaceae | Larix leptolepis | Ref. |
| Plantae | Pinaceae | Larix sibirica | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea excelsa  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Tsuga heterophylla  | Ref. |
| Plantae | Pteridaceae | Pteris vittata | Ref. |
| Plantae | Ranunculaceae | Clematis stans | Ref. |
| Plantae | Ranunculaceae | Coptis japonica var. dissecta  | Ref. |
| Plantae | Rubiaceae | Putoria calabrica | Ref. |
| Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
| Plantae | Simaroubaceae | Leitneria floridana | Ref. |
| Plantae | Solanaceae | Capsicum annum | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nierembergia aristata | Ref. |
| Plantae | Styracaceae | Styrax camporum | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Taxus buccata | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus mairei  | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Thymelaeaceae | Daphne feddei | Ref. |
| Plantae | Thymelaeaceae | Daphne genkwa  | Ref. |
| Plantae | Thymelaeaceae | Daphne mezereum  | Ref. |
| Plantae | Thymelaeaceae | Daphne odora  | Ref. |
| Plantae | Thymelaeaceae | Daphne oleoides spp.  | Ref. |
| Plantae | Thymelaeaceae | Daphne tangutica | Ref. |
| Plantae | Thymelaeaceae | Dirca occidentalis | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme  | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia elliptica | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia sikokiana | Ref. |
|
|
zoom in
| Organism | Taxus buccata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|