| Name |
alpha-Bisabolene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
17627-44-0 |
| C_ID |
C00052803
|
| InChIKey |
YHBUQBJHSRGZNF-VGOFMYFVSA-N |
| InChICode |
InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7+ |
| SMILES |
CC(C)=CC/C=C(C)C1CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araliaceae | Panax ginseng | Ref. |
| Plantae | Labiatae | Ocimum basilicum | Ref. |
| Plantae | Myrtaceae | Psidium guajava | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
| Organism | Zingiber officinale |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
