| Name |
alpha-Ionone (E)-alpha-lonone -alpha-lonone |
| Formula |
C13H20O |
| Mw |
192.15141526 |
| CAS RN |
127-41-3 |
| C_ID |
C00050769
|
| InChIKey |
UZFLPKAIBPNNCA-BQYQJAHWNA-N |
| InChICode |
InChI=1/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h6-8,12H,5,9H2,1-4H3/b8-7+ |
| SMILES |
CC(=O)/C=C/C1C(C)=CCCC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Saussurea lappa  | Ref. |
| Plantae | Ceratophyllaceae | Ceratophyllum demersum  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Rosaceae | Prunus armeniaca L. (K604-19)  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| - | - | Baeckea frutescens L.  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Lawsonia alba | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|