| Name |
Cinchonine
(+)-Cinchonine |
| Formula |
C19H22N2O |
| Mw |
294.17321334 |
| CAS RN |
118-10-5 |
| C_ID |
C00050560
|
| InChIKey |
|
| InChICode |
InChI=1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14-,18+,19-/m0/s1 |
| SMILES |
C=C[C@H]1C[N@]2CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Diaporthaceae | Diaporthe sp. CLF-J | Ref. |
| Plantae | Oleaceae | Ligustrum vulgare  | Ref. |
| Plantae | Oleaceae | Olea europaea | Ref. |
| Plantae | Oleaceae | Olea europea L. | Ref. |
| Plantae | Rubiaceae | Anthocephalus chinensis L. | Ref. |
| Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
| Plantae | Rubiaceae | Cinchona officinalis | Ref. |
| Plantae | Rubiaceae | Cinchona robusta | Ref. |
| Plantae | Rubiaceae | Cinchona succirubra | Ref. |
| Plantae | Rubiaceae | Remijia peruviana | Ref. |
|
|
zoom in
| Organism | Cinchona ledgeriana |
|---|
| Reference | Chang, et al., Dictionary of Chemistry, Science Press, Beijing, (2008).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|
