| Name |
Ascorbic acid |
| Formula |
C6H8O6 |
| Mw |
176.03208799 |
| CAS RN |
62624-30-0 |
| C_ID |
C00050430
|
| InChIKey |
CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| InChICode |
InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/s2 |
| SMILES |
O=C1O[C@@H]([C@H](O)CO)C(O)=C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Fabaceae | Mucuna puriens | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Cola acuminata  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis Linn.  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Crataegus scabrifolia | Ref. |
| Plantae | Solanaceae | Lycium chinense  | Ref. |
| Plantae | Solanaceae | Solanum acaule | Ref. |
| Plantae | Solanaceae | Solanum bulbocastanum | Ref. |
| Plantae | Solanaceae | Solanum canasense | Ref. |
| Plantae | Solanaceae | Solanum cardiophyllum | Ref. |
| Plantae | Solanaceae | Solanum chacoense | Ref. |
| Plantae | Solanaceae | Solanum commersonii  | Ref. |
| Plantae | Solanaceae | Solanum fendleri  | Ref. |
| Plantae | Solanaceae | Solanum hougasii | Ref. |
| Plantae | Solanaceae | Solanum multidissectum | Ref. |
| Plantae | Solanaceae | Solanum phureja | Ref. |
| Plantae | Solanaceae | Solanum pinnactisectum | Ref. |
| Plantae | Solanaceae | Solanum stoloniferum | Ref. |
| Plantae | Solanaceae | Solanum tarijense | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Mucuna puriens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|