| Name |
Sorghumol Isoarborinol |
| Formula |
C30H50O |
| Mw |
426.38616622 |
| CAS RN |
5532-41-2 |
| C_ID |
C00046043
, 
|
| InChIKey |
VWYANPOOORUCFJ-YLFANVDPNA-N |
| InChICode |
InChI=1S/C30H50O/c1-19(2)20-9-12-24-28(20,6)17-18-29(7)22-10-11-23-26(3,4)25(31)14-15-27(23,5)21(22)13-16-30(24,29)8/h13,19-20,22-25,31H,9-12,14-18H2,1-8H3/t20-,22+,23-,24-,25-,27+,28-,29-,30+/m0/s1 |
| SMILES |
CC(C)[C@@H]1CC[C@H]2[C@@]1(C)CC[C@@]1(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)C3=CC[C@]21C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bromeliaceae | Greigia sphacelata  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Poaceae | Imperata cylindrica  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Sorghum bicolor  | Ref. |
| Plantae | Rubiaceae | Hedyotis acutangula | Ref. |
| Plantae | Rubiaceae | Rubia oncotricha | Ref. |
| Plantae | Rutaceae | Glycosmis arborea | Ref. |
| Plantae | Rutaceae | Orixa japonica  | Ref. |
|
|
zoom in
| Organism | Hedyotis acutangula | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Patnam, et al., Journal of Natural Products, 64, (2001), 948 |
|---|
|