| Name |
Vincosamide |
| Formula |
C26H30N2O8 |
| Mw |
498.20021595 |
| CAS RN |
23141-27-7 |
| C_ID |
C00045134
, 
|
| InChIKey |
LBRPLJCNRZUXLS-ZHDJGCKYNA-N |
| InChICode |
InChI=1S/C26H30N2O8/c1-2-12-15-9-18-20-14(13-5-3-4-6-17(13)27-20)7-8-28(18)24(33)16(15)11-34-25(12)36-26-23(32)22(31)21(30)19(10-29)35-26/h2-6,11-12,15,18-19,21-23,25-27,29-32H,1,7-10H2/t12-,15-,18+,19+,21+,22-,23+,25-,26-/m0/s1 |
| SMILES |
C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C2C(=O)N3CCc4c([nH]c5ccccc45)[C@H]3C[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Rubiaceae | Adina racemosa | Ref. |
| Plantae | Rubiaceae | Nauclea orientalis  | Ref. |
| Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla | Ref. |
|
|
zoom in
| Organism | Uncaria rhynchophylla |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Kang, et al., CTHD, 33, (2002), 762.
Zhang, et al., JNP, 64, (2001), 1001.
Zhang, et al., Planta Med, 70, (2004), 1216.
Itoh, et al., JNP, 66, (2003), 1212 |
|---|
|
