| Name |
Propionic acid |
| Formula |
C3H6O2 |
| Mw |
74.03677944 |
| CAS RN |
79-09-4 |
| C_ID |
C00044287
, 
|
| InChIKey |
XBDQKXXYIPTUBI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) |
| SMILES |
CCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Caricaceae | Carica papaya | Ref. |
| Plantae | Convolvulaceae | Cuscuta chinensis | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Ginkgo biloba |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
